CAS 1001413-99-5 appears in our catalog under these names: 1-Benzenesulfonyl-5-fluoro-3-iodo-1h-pyrrolo[2,3-b]pyridine, 95%, 5-Fluoro-3-iodo-1-(phenylsulfonyl)-1H-pyrrolo(2,3-b)pyridine, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g, 50g.
1-(benzenesulfonyl)-5-fluoro-3-iodopyrrolo[2,3-b]pyridine (CAS 1001413-99-5) is a chemical compound with the molecular formula C13H8FIN2O2S and a molecular weight of 402.18 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-fluoro-3-iodopyrrolo[2,3-b]pyridine. InChIKey: KUIWDKYKFUDNNA-UHFFFAOYSA-N.
| Molecular formula | C13H8FIN2O2S |
|---|---|
| Molecular weight | 402.18 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-fluoro-3-iodopyrrolo[2,3-b]pyridine |
| InChIKey | KUIWDKYKFUDNNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2N=CC(=C3)F)I |
Computed by PubChem (NCBI)