Products 1001426-49-8
CAS 1001426-49-8 is the registry number for IMB-26, 98.09%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 50 mg, 5 mg, 10 mg.
3-(2-bromopropanoylamino)-4-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide (CAS 1001426-49-8) is a chemical compound with the molecular formula C20H23BrN2O6 and a molecular weight of 467.3 g/mol. IUPAC name: 3-(2-bromopropanoylamino)-4-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide. InChIKey: FMSAPLQSZMFMOR-UHFFFAOYSA-N.
| Molecular formula | C20H23BrN2O6 |
|---|---|
| Molecular weight | 467.3 g/mol |
| IUPAC name | 3-(2-bromopropanoylamino)-4-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide |
| InChIKey | FMSAPLQSZMFMOR-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C=CC(=C1)C(=O)NC2=CC(=C(C(=C2)OC)OC)OC)OC)Br |
Computed by PubChem (NCBI)