Products 1001478-90-5
CAS 1001478-90-5 appears in our catalog under these names: Choline kinase-A inhibitor, ck37, Choline Kinase-a Inhibitor, 1PC X 5MG, CK37. Offered by: Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 50mg, 5MG, Get quote.
N-(3,5-dimethylphenyl)-2-[[5-(4-ethylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide (CAS 1001478-90-5) is a chemical compound with the molecular formula C20H22N4OS and a molecular weight of 366.5 g/mol. IUPAC name: N-(3,5-dimethylphenyl)-2-[[5-(4-ethylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide. InChIKey: PSJVIOBOAOSNIY-UHFFFAOYSA-N.
| Molecular formula | C20H22N4OS |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | N-(3,5-dimethylphenyl)-2-[[5-(4-ethylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| InChIKey | PSJVIOBOAOSNIY-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC(=NN2)SCC(=O)NC3=CC(=CC(=C3)C)C |
Computed by PubChem (NCBI)