CAS 1001519-41-0 is the registry number for 4-Bromo-1-methyl-5-(trifluoromethyl)-1h-pyrazole-3-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbohydrazide (CAS 1001519-41-0) is a chemical compound with the molecular formula C6H6BrF3N4O and a molecular weight of 287.04 g/mol. IUPAC name: 4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbohydrazide. InChIKey: BPSXQIKGHPFXQR-UHFFFAOYSA-N.
| Molecular formula | C6H6BrF3N4O |
|---|---|
| Molecular weight | 287.04 g/mol |
| IUPAC name | 4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbohydrazide |
| InChIKey | BPSXQIKGHPFXQR-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(=O)NN)Br)C(F)(F)F |
Computed by PubChem (NCBI)