CAS 100155-47-3 appears in our catalog under these names: Diazinon-D10 (99.0 ATOM% D), Diazinon-d10, Diazinon-d10, >95% (HPLC), Diazinon D10 (diethyl D10), Diazinon D10 (diethyl D10) 100 µg/mL in Acetone. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, Sigma-Aldrich. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 1ml, 0,01g, 5MG, 1 mg.
(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-lambda5-phosphane (CAS 100155-47-3) is a chemical compound with the molecular formula C12H21N2O3PS and a molecular weight of 314.41 g/mol. IUPAC name: (6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-lambda5-phosphane. InChIKey: FHIVAFMUCKRCQO-HXOHQZFQSA-N.
| Molecular formula | C12H21N2O3PS |
|---|---|
| Molecular weight | 314.41 g/mol |
| IUPAC name | (6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-lambda5-phosphane |
| InChIKey | FHIVAFMUCKRCQO-HXOHQZFQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=S)(OC1=NC(=NC(=C1)C)C(C)C)OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)