Products 1001571-08-9
CAS 1001571-08-9 is the registry number for IMB5046. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(4-methylsulfanylphenyl)methyl 2-morpholin-4-yl-5-nitrobenzoate (CAS 1001571-08-9) is a chemical compound with the molecular formula C19H20N2O5S and a molecular weight of 388.4 g/mol. IUPAC name: (4-methylsulfanylphenyl)methyl 2-morpholin-4-yl-5-nitrobenzoate. InChIKey: VPXGOSNPXCNGAI-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O5S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | (4-methylsulfanylphenyl)methyl 2-morpholin-4-yl-5-nitrobenzoate |
| InChIKey | VPXGOSNPXCNGAI-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)COC(=O)C2=C(C=CC(=C2)[N+](=O)[O-])N3CCOCC3 |
Computed by PubChem (NCBI)