CAS 10016-52-1 appears in our catalog under these names: 2,8–dibromodibenzofuran, 2,8-Dibromodibenzofuran, >98.0%(GC), 2,8-Dibromodibenzo[b,d]furan 97%, 2,8-Dibromodibenzo[b,d]furan, 97%, 97%, 2,8-Dibromodibenzo[b,d]furan, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g.
2,8-dibromodibenzofuran (CAS 10016-52-1) is a chemical compound with the molecular formula C12H6Br2O and a molecular weight of 325.98 g/mol. IUPAC name: 2,8-dibromodibenzofuran. InChIKey: UFCZRCPQBWIXTR-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2O |
|---|---|
| Molecular weight | 325.98 g/mol |
| IUPAC name | 2,8-dibromodibenzofuran |
| InChIKey | UFCZRCPQBWIXTR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)