CAS 1001645-58-4 appears in our catalog under these names: SRT1720 Hydrochloride, >95% (HPLC), SRT1720 hydrochloride/ 99.59% (existing batch purity), SRT1720 HCl, SRT1720 hydrochloride, SRT 1720 HCl 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 10mg, 50mg, 5mg, 1mg, 2mg, 25mg, 100mg, 200mg.
N-[2-[3-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide;hydrochloride (CAS 1001645-58-4) is a chemical compound with the molecular formula C25H24ClN7OS and a molecular weight of 506.0 g/mol. IUPAC name: N-[2-[3-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide;hydrochloride. InChIKey: DTGRRMPPXCRRIM-UHFFFAOYSA-N.
| Molecular formula | C25H24ClN7OS |
|---|---|
| Molecular weight | 506.0 g/mol |
| IUPAC name | N-[2-[3-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide;hydrochloride |
| InChIKey | DTGRRMPPXCRRIM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CSC3=NC(=CN23)C4=CC=CC=C4NC(=O)C5=NC6=CC=CC=C6N=C5.Cl |
Computed by PubChem (NCBI)