CAS 1001757-56-7 appears in our catalog under these names: 4-Bromo-1-(2-fluorobenzyl)-1h-pyrazol-3-amine, 95%, 4-Bromo-1-((2-fluorophenyl)methyl)-1H-pyrazol-3-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-amine (CAS 1001757-56-7) is a chemical compound with the molecular formula C10H9BrFN3 and a molecular weight of 270.10 g/mol. IUPAC name: 4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-amine. InChIKey: QFZUXIIBOIRIPL-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFN3 |
|---|---|
| Molecular weight | 270.10 g/mol |
| IUPAC name | 4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-amine |
| InChIKey | QFZUXIIBOIRIPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(C(=N2)N)Br)F |
Computed by PubChem (NCBI)