Products 10018-19-6
CAS 10018-19-6 appears in our catalog under these names: Cotarnine Chloride, Cotarnine Chloride, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 50mg, 5mg, 1mg, 0,5mg, 2mg, 10mg.
4-methoxy-6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium chloride (CAS 10018-19-6) is a chemical compound with the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. IUPAC name: 4-methoxy-6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium chloride. InChIKey: BWQAGVANIBSWBW-UHFFFAOYSA-M.
| Molecular formula | C12H14ClNO3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 4-methoxy-6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium chloride |
| InChIKey | BWQAGVANIBSWBW-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC2=C(C3=C(C=C2CC1)OCO3)OC.[Cl-] |
Computed by PubChem (NCBI)