CAS 100187-70-0 appears in our catalog under these names: 4–Allyl–2,6–dimethoxyphenyl glucoside, Erigeside II. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(2S,3R,4S,5S,6R)-2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 100187-70-0) is a chemical compound with the molecular formula C17H24O8 and a molecular weight of 356.4 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: GJDGTVUZKDKLQP-GAGVYUBLSA-N.
| Molecular formula | C17H24O8 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-(2,6-dimethoxy-4-prop-2-enylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | GJDGTVUZKDKLQP-GAGVYUBLSA-N |
| SMILES | COC1=CC(=CC(=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC)CC=C |
Computed by PubChem (NCBI)