CAS 100189-81-9 appears in our catalog under these names: 1,2-Ethane-d4-dithiol, 99 atom % D, min 98% Chemical Purity, 1,2-Ethanedithiol-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1,1,2,2-tetradeuterioethane-1,2-dithiol (CAS 100189-81-9) is a chemical compound with the molecular formula C2H6S2 and a molecular weight of 98.23 g/mol. IUPAC name: 1,1,2,2-tetradeuterioethane-1,2-dithiol. InChIKey: VYMPLPIFKRHAAC-LNLMKGTHSA-N.
| Molecular formula | C2H6S2 |
|---|---|
| Molecular weight | 98.23 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterioethane-1,2-dithiol |
| InChIKey | VYMPLPIFKRHAAC-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])S)S |
Computed by PubChem (NCBI)