CAS 100191-28-4 appears in our catalog under these names: 4-Chloro-3-nitrobenzenethiol, 4-Chloro-3-nitrobenzenethiol, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 500mg, 250mg, 1000mg, 100mg, 1g.
4-chloro-3-nitrobenzenethiol (CAS 100191-28-4) is a chemical compound with the molecular formula C6H4ClNO2S and a molecular weight of 189.62 g/mol. IUPAC name: 4-chloro-3-nitrobenzenethiol. InChIKey: IAYMABJPMMKXFR-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO2S |
|---|---|
| Molecular weight | 189.62 g/mol |
| IUPAC name | 4-chloro-3-nitrobenzenethiol |
| InChIKey | IAYMABJPMMKXFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)