CAS 1001994-57-5 is the registry number for N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl[(5-methyl-2-furanyl)methyl]amino]acetamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
2-amino-4-(4-methylphenyl)-6-phenylpyridine-3-carbonitrile (CAS 1001994-57-5) is a chemical compound with the molecular formula C19H15N3 and a molecular weight of 285.3 g/mol. IUPAC name: 2-amino-4-(4-methylphenyl)-6-phenylpyridine-3-carbonitrile. InChIKey: ADSZRHDJWBZORK-UHFFFAOYSA-N.
| Molecular formula | C19H15N3 |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 2-amino-4-(4-methylphenyl)-6-phenylpyridine-3-carbonitrile |
| InChIKey | ADSZRHDJWBZORK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NC(=C2C#N)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)