CAS 1002113-68-9 is the registry number for (Dimethylphenylphosphine)(2-methyl-2-propanethiolato)gold(I), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl(phenyl)phosphanium;gold(1+);2-methylpropane-2-thiolate (CAS 1002113-68-9) is a chemical compound with the molecular formula C12H21AuPS+ and a molecular weight of 425.30 g/mol. IUPAC name: dimethyl(phenyl)phosphanium;gold(1+);2-methylpropane-2-thiolate. InChIKey: GUSSDRCPEUTLDD-UHFFFAOYSA-N.
| Molecular formula | C12H21AuPS+ |
|---|---|
| Molecular weight | 425.30 g/mol |
| IUPAC name | dimethyl(phenyl)phosphanium;gold(1+);2-methylpropane-2-thiolate |
| InChIKey | GUSSDRCPEUTLDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[S-].C[PH+](C)C1=CC=CC=C1.[Au+] |
Computed by PubChem (NCBI)