CAS 1002113-69-0 is the registry number for (Methyldiphenylphosphine)(2-methyl-2-propanethiolato)gold(I), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Gold(1+);methyl(diphenyl)phosphanium;2-methylpropane-2-thiolate (CAS 1002113-69-0) is a chemical compound with the molecular formula C17H23AuPS+ and a molecular weight of 487.4 g/mol. IUPAC name: gold(1+);methyl(diphenyl)phosphanium;2-methylpropane-2-thiolate. InChIKey: VXRSMVXXTXOFKU-UHFFFAOYSA-N.
| Molecular formula | C17H23AuPS+ |
|---|---|
| Molecular weight | 487.4 g/mol |
| IUPAC name | gold(1+);methyl(diphenyl)phosphanium;2-methylpropane-2-thiolate |
| InChIKey | VXRSMVXXTXOFKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[S-].C[PH+](C1=CC=CC=C1)C2=CC=CC=C2.[Au+] |
Computed by PubChem (NCBI)