CAS 1002113-78-1 is the registry number for (2,2-Dimethyl-1-propanethiolato)(triphenylphosphine)gold, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethylpropane-1-thiolate;gold(1+);triphenylphosphanium (CAS 1002113-78-1) is a chemical compound with the molecular formula C23H27AuPS+ and a molecular weight of 563.5 g/mol. IUPAC name: 2,2-dimethylpropane-1-thiolate;gold(1+);triphenylphosphanium. InChIKey: CNSPVQQVKKHGGU-UHFFFAOYSA-N.
| Molecular formula | C23H27AuPS+ |
|---|---|
| Molecular weight | 563.5 g/mol |
| IUPAC name | 2,2-dimethylpropane-1-thiolate;gold(1+);triphenylphosphanium |
| InChIKey | CNSPVQQVKKHGGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C[S-].C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=C3.[Au+] |
Computed by PubChem (NCBI)