CAS 1002728-74-6 is the registry number for (4R)-4-(2,4-Difluorophenyl)pyrrolidine-3-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-4-(2,4-difluorophenyl)pyrrolidine-3-carbonitrile (CAS 1002728-74-6) is a chemical compound with the molecular formula C11H10F2N2 and a molecular weight of 208.21 g/mol. IUPAC name: (4R)-4-(2,4-difluorophenyl)pyrrolidine-3-carbonitrile. InChIKey: KNAWRMFTRHCYTJ-OMNKOJBGSA-N.
| Molecular formula | C11H10F2N2 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (4R)-4-(2,4-difluorophenyl)pyrrolidine-3-carbonitrile |
| InChIKey | KNAWRMFTRHCYTJ-OMNKOJBGSA-N |
| SMILES | C1[C@H](C(CN1)C#N)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)