CAS 100276-65-1 is the registry number for Ethyl 6,7,8-trifluoro-1-(formylmethylamino)-1,4-dihydro-4-oxo-3-quinolinecarboxylate. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
Ethyl 6,7,8-trifluoro-1-[formyl(methyl)amino]-4-oxoquinoline-3-carboxylate (CAS 100276-65-1) is a chemical compound with the molecular formula C14H11F3N2O4 and a molecular weight of 328.24 g/mol. IUPAC name: ethyl 6,7,8-trifluoro-1-[formyl(methyl)amino]-4-oxoquinoline-3-carboxylate. InChIKey: IABQCXKNOGCUPS-UHFFFAOYSA-N.
| Molecular formula | C14H11F3N2O4 |
|---|---|
| Molecular weight | 328.24 g/mol |
| IUPAC name | ethyl 6,7,8-trifluoro-1-[formyl(methyl)amino]-4-oxoquinoline-3-carboxylate |
| InChIKey | IABQCXKNOGCUPS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C2=C(C(=C(C=C2C1=O)F)F)F)N(C)C=O |
Computed by PubChem (NCBI)