CAS 100299-08-9 appears in our catalog under these names: Pemirolast Potassium Salt, Pemirolast potassium/ 99.89% (existing batch purity), Pemirolast potassium, Pemirolast potassium, Pemirolast Potassium, >98.0%(HPLC)(T). Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5g.
Potassium 9-methyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrido[1,2-a]pyrimidin-4-one (CAS 100299-08-9) is a chemical compound with the molecular formula C10H7KN6O and a molecular weight of 266.30 g/mol. IUPAC name: potassium 9-methyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrido[1,2-a]pyrimidin-4-one. InChIKey: NMMVKSMGBDRONO-UHFFFAOYSA-N.
| Molecular formula | C10H7KN6O |
|---|---|
| Molecular weight | 266.30 g/mol |
| IUPAC name | potassium 9-methyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | NMMVKSMGBDRONO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC=C(C2=O)C3=NN=N[N-]3.[K+] |
Computed by PubChem (NCBI)