CAS 100306-24-9 is the registry number for (S)-2-bromo-1-(4-bromophenyl)ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1S)-2-bromo-1-(4-bromophenyl)ethanol (CAS 100306-24-9) is a chemical compound with the molecular formula C8H8Br2O and a molecular weight of 279.96 g/mol. IUPAC name: (1S)-2-bromo-1-(4-bromophenyl)ethanol. InChIKey: ZOCCHBFOKYCUST-MRVPVSSYSA-N.
| Molecular formula | C8H8Br2O |
|---|---|
| Molecular weight | 279.96 g/mol |
| IUPAC name | (1S)-2-bromo-1-(4-bromophenyl)ethanol |
| InChIKey | ZOCCHBFOKYCUST-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CBr)O)Br |
Computed by PubChem (NCBI)