CAS 1003091-20-0 appears in our catalog under these names: H4R antagonist 3, H4R antagonist 3 99%, H4R Antagonist 3, ≥98%, ≥98%, H4R antagonist 3, 96.29%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 500mg, 10 mg.
5-(4-chlorophenyl)-N-methyl-N-(1-methylpiperidin-4-yl)thieno[2,3-d]pyrimidin-4-amine (CAS 1003091-20-0) is a chemical compound with the molecular formula C19H21ClN4S and a molecular weight of 372.9 g/mol. IUPAC name: 5-(4-chlorophenyl)-N-methyl-N-(1-methylpiperidin-4-yl)thieno[2,3-d]pyrimidin-4-amine. InChIKey: IYOAEBAARGYYSQ-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN4S |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-N-methyl-N-(1-methylpiperidin-4-yl)thieno[2,3-d]pyrimidin-4-amine |
| InChIKey | IYOAEBAARGYYSQ-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)N(C)C2=C3C(=CSC3=NC=N2)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)