Products 100313-76-6
CAS 100313-76-6 is the registry number for Methyl 2-chloro-3-cyano-6-methyl-5-nitroisonicotinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-3-cyano-6-methyl-5-nitropyridine-4-carboxylate (CAS 100313-76-6) is a chemical compound with the molecular formula C9H6ClN3O4 and a molecular weight of 255.61 g/mol. IUPAC name: methyl 2-chloro-3-cyano-6-methyl-5-nitropyridine-4-carboxylate. InChIKey: QPUWBHSGEGEBOK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O4 |
|---|---|
| Molecular weight | 255.61 g/mol |
| IUPAC name | methyl 2-chloro-3-cyano-6-methyl-5-nitropyridine-4-carboxylate |
| InChIKey | QPUWBHSGEGEBOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)Cl)C#N)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)