Products 1003216-77-0
CAS 1003216-77-0 is the registry number for (R)-PD 0325901CL. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-chloro-4-iodoanilino)-N-[(2R)-2,3-dihydroxypropoxy]-3,4-difluorobenzamide (CAS 1003216-77-0) is a chemical compound with the molecular formula C16H14ClF2IN2O4 and a molecular weight of 498.65 g/mol. IUPAC name: 2-(2-chloro-4-iodoanilino)-N-[(2R)-2,3-dihydroxypropoxy]-3,4-difluorobenzamide. InChIKey: FCADPEDUULETPK-SECBINFHSA-N.
| Molecular formula | C16H14ClF2IN2O4 |
|---|---|
| Molecular weight | 498.65 g/mol |
| IUPAC name | 2-(2-chloro-4-iodoanilino)-N-[(2R)-2,3-dihydroxypropoxy]-3,4-difluorobenzamide |
| InChIKey | FCADPEDUULETPK-SECBINFHSA-N |
| SMILES | C1=CC(=C(C=C1I)Cl)NC2=C(C=CC(=C2F)F)C(=O)NOC[C@@H](CO)O |
Computed by PubChem (NCBI)