CAS 1003298-84-7 appears in our catalog under these names: 3-Chloro-4-hydroxy-5-methoxyphenylboronic acid, pinacol ester, 96%, 2-Chloro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-chloro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1003298-84-7) is a chemical compound with the molecular formula C13H18BClO4 and a molecular weight of 284.54 g/mol. IUPAC name: 2-chloro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: XBEJPOZGAPQFPL-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO4 |
|---|---|
| Molecular weight | 284.54 g/mol |
| IUPAC name | 2-chloro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | XBEJPOZGAPQFPL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)O)OC |
Computed by PubChem (NCBI)