CAS 100367-74-6 appears in our catalog under these names: 4-Bromo-2-methylpyridine 1-oxide, 95%, 4-Bromo-2-methylpyridine 1-oxide, 97%, 4–Bromo–2–methylpyridine 1–oxide, 4-Bromo-2-methylpyridine 1-oxide, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-bromo-2-methyl-1-oxidopyridin-1-ium (CAS 100367-74-6) is a chemical compound with the molecular formula C6H6BrNO and a molecular weight of 188.02 g/mol. IUPAC name: 4-bromo-2-methyl-1-oxidopyridin-1-ium. InChIKey: WRQSJBNVXAEYSB-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO |
|---|---|
| Molecular weight | 188.02 g/mol |
| IUPAC name | 4-bromo-2-methyl-1-oxidopyridin-1-ium |
| InChIKey | WRQSJBNVXAEYSB-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=CC(=C1)Br)[O-] |
Computed by PubChem (NCBI)