CAS 1003856-43-6 is the registry number for 1-Benzenesulfonyl-3,4-dibromo-1H-pyrrole, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(benzenesulfonyl)-3,4-dibromopyrrole (CAS 1003856-43-6) is a chemical compound with the molecular formula C10H7Br2NO2S and a molecular weight of 365.04 g/mol. IUPAC name: 1-(benzenesulfonyl)-3,4-dibromopyrrole. InChIKey: KJBIDAOQEYSQSO-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO2S |
|---|---|
| Molecular weight | 365.04 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-3,4-dibromopyrrole |
| InChIKey | KJBIDAOQEYSQSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C(=C2)Br)Br |
Computed by PubChem (NCBI)