CAS 1004-16-6 appears in our catalog under these names: 3-Cyano-1-methylpyridinium iodide, 95%, 3-Cyano-1-methylpyridin-1-ium iodide, 95%, 3–Cyano–1–methylpyridin–1–ium iodide, 3-Cyano-1-methylpyridin-1-ium iodide. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g, 50mg, 500mg.
1-methylpyridin-1-ium-3-carbonitrile iodide (CAS 1004-16-6) is a chemical compound with the molecular formula C7H7IN2 and a molecular weight of 246.05 g/mol. IUPAC name: 1-methylpyridin-1-ium-3-carbonitrile iodide. InChIKey: QOYXETVGUYSYRK-UHFFFAOYSA-M.
| Molecular formula | C7H7IN2 |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | 1-methylpyridin-1-ium-3-carbonitrile iodide |
| InChIKey | QOYXETVGUYSYRK-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=CC(=C1)C#N.[I-] |
Computed by PubChem (NCBI)