Products 1004-98-4

CAS 1004-98-4 appears in our catalog under these names: 2,5-Diazabicyclo[2.2.2]octane-3,6-dione, 95%, 2,5-Diazabicyclo(2.2.2)octane-3,6-dione, 2,5-Diazabicyclo(2.2.2)octane-3,6-dione, 95+%, 2,5–Diazabicyclo(2·2·2)octane–3,6–dione, 2,5-DIAZABICYCLO[2.2.2]OCTANE-3,6-DIONE, >95%, >95%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 750mg, 50mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2,5-diazabicyclo[2.2.2]octane-3,6-dione (CAS 1004-98-4) is a chemical compound with the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. IUPAC name: 2,5-diazabicyclo[2.2.2]octane-3,6-dione. InChIKey: PPSCFPAFAMAAHE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O2
Molecular weight140.14 g/mol
IUPAC name2,5-diazabicyclo[2.2.2]octane-3,6-dione
InChIKeyPPSCFPAFAMAAHE-UHFFFAOYSA-N
SMILESC1CC2C(=O)NC1C(=O)N2

Computed by PubChem (NCBI)