CAS 10040-44-5 appears in our catalog under these names: Sodium propane-2,2-diylbis(4,1-phenylene) bis(sulfate), 98%, Bisphenol A Bissulfate Disodium Salt, Bisphenol A bissulfate (disodium). Offered by: Chemat Brand, TRC, MedChemExpress, HPC Standards. Available pack sizes: on request, 250mg, 25mg, 10 mg, 5 mg, 25 mg, 1x10mg.
Disodium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate (CAS 10040-44-5) is a chemical compound with the molecular formula C15H14Na2O8S2 and a molecular weight of 432.4 g/mol. IUPAC name: disodium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate. InChIKey: OAPPROYXVPMBRW-UHFFFAOYSA-L.
| Molecular formula | C15H14Na2O8S2 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | disodium;[4-[2-(4-sulfonatooxyphenyl)propan-2-yl]phenyl] sulfate |
| InChIKey | OAPPROYXVPMBRW-UHFFFAOYSA-L |
| SMILES | CC(C)(C1=CC=C(C=C1)OS(=O)(=O)[O-])C2=CC=C(C=C2)OS(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)