CAS 1004018-33-0 is the registry number for 1-(4-Bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethyl-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethylpyrazole (CAS 1004018-33-0) is a chemical compound with the molecular formula C11H7BrF4N2 and a molecular weight of 323.08 g/mol. IUPAC name: 1-(4-bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethylpyrazole. InChIKey: WMLCBPHIPJNNDM-UHFFFAOYSA-N.
| Molecular formula | C11H7BrF4N2 |
|---|---|
| Molecular weight | 323.08 g/mol |
| IUPAC name | 1-(4-bromo-2,3,5,6-tetrafluorophenyl)-3,5-dimethylpyrazole |
| InChIKey | WMLCBPHIPJNNDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C(=C(C(=C2F)F)Br)F)F)C |
Computed by PubChem (NCBI)