Products 1004193-30-9

CAS 1004193-30-9 is the registry number for 1-((2-Chloro-4-nitrophenoxy)methyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carboxylic acid (CAS 1004193-30-9) is a chemical compound with the molecular formula C11H8ClN3O5 and a molecular weight of 297.65 g/mol. IUPAC name: 1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carboxylic acid. InChIKey: QIGBFIITMBVCLI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClN3O5
Molecular weight297.65 g/mol
IUPAC name1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carboxylic acid
InChIKeyQIGBFIITMBVCLI-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1[N+](=O)[O-])Cl)OCN2C=CC(=N2)C(=O)O

Computed by PubChem (NCBI)