CAS 1004194-42-6 is the registry number for 1-((3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxylic acid (CAS 1004194-42-6) is a chemical compound with the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. IUPAC name: 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxylic acid. InChIKey: BNIINTVTTXLOGO-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O4 |
|---|---|
| Molecular weight | 265.23 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxylic acid |
| InChIKey | BNIINTVTTXLOGO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CN2C=CC(=N2)C(=O)O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)