CAS 1004194-66-4 is the registry number for 4-Chloro-1-((2,6-dichlorophenyl)methyl)-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-amine (CAS 1004194-66-4) is a chemical compound with the molecular formula C10H8Cl3N3 and a molecular weight of 276.5 g/mol. IUPAC name: 4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-amine. InChIKey: WZCQIGJJWMCICA-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl3N3 |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | 4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-amine |
| InChIKey | WZCQIGJJWMCICA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CN2C=C(C(=N2)N)Cl)Cl |
Computed by PubChem (NCBI)