CAS 1004452-01-0 is the registry number for 4-Chloro-1-(1-ethyl-5-methyl-1 H -pyrazol-4-ylmethyl)-1 H -pyrazol-3-ylamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-3-amine (CAS 1004452-01-0) is a chemical compound with the molecular formula C10H14ClN5 and a molecular weight of 239.70 g/mol. IUPAC name: 4-chloro-1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-3-amine. InChIKey: YAZJIZOTEGJFER-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN5 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 4-chloro-1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-3-amine |
| InChIKey | YAZJIZOTEGJFER-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)CN2C=C(C(=N2)N)Cl)C |
Computed by PubChem (NCBI)