Products 1004944-59-5

CAS 1004944-59-5 is the registry number for 2-(3-(4-Bromo-3-nitro-1H-pyrazol-1-yl)adamantan-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetic acid (CAS 1004944-59-5) is a chemical compound with the molecular formula C15H18BrN3O4 and a molecular weight of 384.22 g/mol. IUPAC name: 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetic acid. InChIKey: LIFHFMVOSXLOLB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18BrN3O4
Molecular weight384.22 g/mol
IUPAC name2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]acetic acid
InChIKeyLIFHFMVOSXLOLB-UHFFFAOYSA-N
SMILESC1C2CC3(CC1CC(C2)(C3)N4C=C(C(=N4)[N+](=O)[O-])Br)CC(=O)O

Computed by PubChem (NCBI)