CAS 1005-31-8 appears in our catalog under these names: 4-(Dimethylamino)pyridine n-oxide hydrate, 98%, 4–(Dimethylamino)pyridine N–Oxide Hydrate, 4-(Dimethylamino)pyridine N-Oxide, >98.0%(T), 4-Dimethylaminopyridine N-oxide, 98.14%, 4-Dimethylaminopyridine N-oxide, 98% (hydrate). Offered by: Combi-blocks, GLPBio, TCI, MedChemExpress, Ambeed. Available pack sizes: 250mg, 5g, 1g, 250 mg, 100 mg, 500 mg, 1 g, 100mg.
N,N-dimethyl-1-oxidopyridin-1-ium-4-amine (CAS 1005-31-8) is a chemical compound with the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. IUPAC name: N,N-dimethyl-1-oxidopyridin-1-ium-4-amine. InChIKey: WZMNQOYCHMGCSS-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O |
|---|---|
| Molecular weight | 138.17 g/mol |
| IUPAC name | N,N-dimethyl-1-oxidopyridin-1-ium-4-amine |
| InChIKey | WZMNQOYCHMGCSS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=[N+](C=C1)[O-] |
Computed by PubChem (NCBI)