CAS 100516-61-8 appears in our catalog under these names: 1,2,3,4,5,6-Hexaethynylbenzene, 95%, 1,2,3,4,5,6-Hexaethynylbenzene. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2g, 5g, 10g, 25g, 50g.
1,2,3,4,5,6-hexaethynylbenzene (CAS 100516-61-8) is a chemical compound with the molecular formula C18H6 and a molecular weight of 222.2 g/mol. IUPAC name: 1,2,3,4,5,6-hexaethynylbenzene. InChIKey: VXFRCHRNRILBMZ-UHFFFAOYSA-N.
| Molecular formula | C18H6 |
|---|---|
| Molecular weight | 222.2 g/mol |
| IUPAC name | 1,2,3,4,5,6-hexaethynylbenzene |
| InChIKey | VXFRCHRNRILBMZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C(=C(C(=C1C#C)C#C)C#C)C#C)C#C |
Computed by PubChem (NCBI)