Products 1005199-84-7
CAS 1005199-84-7 is the registry number for GSK-3β inhibitor 22, 99.38%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 10mM/1mL.
2-(1,3-benzothiazol-6-yl)-5-[[4-methoxy-3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-oxadiazole (CAS 1005199-84-7) is a chemical compound with the molecular formula C18H12F3N3O2S2 and a molecular weight of 423.4 g/mol. IUPAC name: 2-(1,3-benzothiazol-6-yl)-5-[[4-methoxy-3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-oxadiazole. InChIKey: UTBCIKFSECWBOH-UHFFFAOYSA-N.
| Molecular formula | C18H12F3N3O2S2 |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-6-yl)-5-[[4-methoxy-3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-oxadiazole |
| InChIKey | UTBCIKFSECWBOH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CSC2=NN=C(O2)C3=CC4=C(C=C3)N=CS4)C(F)(F)F |
Computed by PubChem (NCBI)