Products 1005201-59-1
CAS 1005201-59-1 is the registry number for Potassium (E)-trifluoro(3-phenylprop-1-en-1-yl)borate, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
Potassium trifluoro-[(E)-3-phenylprop-1-enyl]boranuide (CAS 1005201-59-1) is a chemical compound with the molecular formula C9H9BF3K and a molecular weight of 224.07 g/mol. IUPAC name: potassium trifluoro-[(E)-3-phenylprop-1-enyl]boranuide. InChIKey: SNELUEBTICJTGF-ZFXMFRGYSA-N.
| Molecular formula | C9H9BF3K |
|---|---|
| Molecular weight | 224.07 g/mol |
| IUPAC name | potassium trifluoro-[(E)-3-phenylprop-1-enyl]boranuide |
| InChIKey | SNELUEBTICJTGF-ZFXMFRGYSA-N |
| SMILES | [B-](/C=C/CC1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)