CAS 100524-07-0 appears in our catalog under these names: 3-Amino-benzamide oxime, 95%, 3–amino Benzamidoxime, 3-Aminobenzamide oxime, 3-Amino benzamidoxime, 98.31%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 500mg, 1 g, 250 mg, 100 mg.
3-amino-N'-hydroxybenzenecarboximidamide (CAS 100524-07-0) is a chemical compound with the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. IUPAC name: 3-amino-N'-hydroxybenzenecarboximidamide. InChIKey: OPGWBTKZYLRPRW-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O |
|---|---|
| Molecular weight | 151.17 g/mol |
| IUPAC name | 3-amino-N'-hydroxybenzenecarboximidamide |
| InChIKey | OPGWBTKZYLRPRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)/C(=N/O)/N |
Computed by PubChem (NCBI)