CAS 1005288-15-2 appears in our catalog under these names: β-catenin-IN-3, 98%, 98%, β-catenin-IN-3, 98.03%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 25 mg, 10 mg, 1 mg, 5 mg, 10mM/1mL.
1-[(E)-2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]-3-(8-tricyclo[5.2.1.02,6]dec-4-enyl)thiourea (CAS 1005288-15-2) is a chemical compound with the molecular formula C19H20Br2N2OS and a molecular weight of 484.2 g/mol. IUPAC name: 1-[(E)-2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]-3-(8-tricyclo[5.2.1.02,6]dec-4-enyl)thiourea. InChIKey: VPOJWIBWEJWBKC-SNAWJCMRSA-N.
| Molecular formula | C19H20Br2N2OS |
|---|---|
| Molecular weight | 484.2 g/mol |
| IUPAC name | 1-[(E)-2-(3,5-dibromo-2-hydroxyphenyl)ethenyl]-3-(8-tricyclo[5.2.1.02,6]dec-4-enyl)thiourea |
| InChIKey | VPOJWIBWEJWBKC-SNAWJCMRSA-N |
| SMILES | C1C=CC2C1C3CC2C(C3)NC(=S)N/C=C/C4=C(C(=CC(=C4)Br)Br)O |
Computed by PubChem (NCBI)