CAS 1005326-32-8 is the registry number for 2-Amino-6-methyl-1,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-methyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (CAS 1005326-32-8) is a chemical compound with the molecular formula C7H8N4O and a molecular weight of 164.16 g/mol. IUPAC name: 2-amino-6-methyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one. InChIKey: DOUIPEWOIUIIOR-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 2-amino-6-methyl-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | DOUIPEWOIUIIOR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)