CAS 1005334-57-5 appears in our catalog under these names: CVT 10216, 3-(((3-(4-((Methylsulfonyl)amino)phenyl)-4-oxo-4H-chromen-7-yl)oxy)methyl)benzoic Acid, CVT-10216/ 99.16% (existing batch purity), CVT-10216 95%, 3-[[[3-[4-[(Methylsulfonyl)amino]phenyl]-4-oxo-4H-chromen-7-yl]oxy]methyl]benzoic Acid, 95%, 95%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 500mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg.
3-[[3-[4-(methanesulfonamido)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoic acid (CAS 1005334-57-5) is a chemical compound with the molecular formula C24H19NO7S and a molecular weight of 465.5 g/mol. IUPAC name: 3-[[3-[4-(methanesulfonamido)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoic acid. InChIKey: YYOOFJZTRCPVFD-UHFFFAOYSA-N.
| Molecular formula | C24H19NO7S |
|---|---|
| Molecular weight | 465.5 g/mol |
| IUPAC name | 3-[[3-[4-(methanesulfonamido)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoic acid |
| InChIKey | YYOOFJZTRCPVFD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)OCC4=CC(=CC=C4)C(=O)O |
Computed by PubChem (NCBI)