CAS 1005412-64-5 is the registry number for N1–(2,4–Dinitrophenyl)–3,6,9,12–tetraoxatetradecane–1,14–diamine. Offered by: GLPBio. Available pack sizes: 100mg, 250mg, 500mg.
N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2,4-dinitroaniline (CAS 1005412-64-5) is a chemical compound with the molecular formula C16H26N4O8 and a molecular weight of 402.40 g/mol. IUPAC name: N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2,4-dinitroaniline. InChIKey: RFIIUTMBCFUVCY-UHFFFAOYSA-N.
| Molecular formula | C16H26N4O8 |
|---|---|
| Molecular weight | 402.40 g/mol |
| IUPAC name | N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2,4-dinitroaniline |
| InChIKey | RFIIUTMBCFUVCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)