CAS 1005565-98-9 appears in our catalog under these names: 5-([3,5-Bis(difluoromethyl)-1h-pyrazol-1-yl]methyl)-2-furoic acid, 95%, 5-{(3,5-Bis(difluoromethyl)-1H-pyrazol-1-yl)methyl}furan-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 5g.
5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]furan-2-carboxylic acid (CAS 1005565-98-9) is a chemical compound with the molecular formula C11H8F4N2O3 and a molecular weight of 292.19 g/mol. IUPAC name: 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]furan-2-carboxylic acid. InChIKey: FMVSKIITQBZQHN-UHFFFAOYSA-N.
| Molecular formula | C11H8F4N2O3 |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 5-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]furan-2-carboxylic acid |
| InChIKey | FMVSKIITQBZQHN-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)CN2C(=CC(=N2)C(F)F)C(F)F |
Computed by PubChem (NCBI)