CAS 1005586-13-9 appears in our catalog under these names: 2-[3,5-Bis(difluoromethyl)-1h-pyrazol-1-yl]propanoic acid, 95%, 2-(3,5-Bis(difluoromethyl)-1H-pyrazol-1-yl)propanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg.
2-[3,5-bis(difluoromethyl)pyrazol-1-yl]propanoic acid (CAS 1005586-13-9) is a chemical compound with the molecular formula C8H8F4N2O2 and a molecular weight of 240.15 g/mol. IUPAC name: 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]propanoic acid. InChIKey: NELRRJQUCQJLEC-UHFFFAOYSA-N.
| Molecular formula | C8H8F4N2O2 |
|---|---|
| Molecular weight | 240.15 g/mol |
| IUPAC name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]propanoic acid |
| InChIKey | NELRRJQUCQJLEC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=CC(=N1)C(F)F)C(F)F |
Computed by PubChem (NCBI)