CAS 100574-22-9 appears in our catalog under these names: Thioridazine EP Impurity A, 5,5-Dioxide Thioridazine Disulfoxide, Thioridazine impurity 3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 50mg, Get quote.
10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfonylphenothiazine 5,5-dioxide (CAS 100574-22-9) is a chemical compound with the molecular formula C21H26N2O4S2 and a molecular weight of 434.6 g/mol. IUPAC name: 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfonylphenothiazine 5,5-dioxide. InChIKey: YECWCJHGQWLNLB-UHFFFAOYSA-N.
| Molecular formula | C21H26N2O4S2 |
|---|---|
| Molecular weight | 434.6 g/mol |
| IUPAC name | 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfonylphenothiazine 5,5-dioxide |
| InChIKey | YECWCJHGQWLNLB-UHFFFAOYSA-N |
| SMILES | CN1CCCCC1CCN2C3=CC=CC=C3S(=O)(=O)C4=C2C=C(C=C4)S(=O)(=O)C |
Computed by PubChem (NCBI)