CAS 1005786-10-6 is the registry number for Ethyl 6-iodoimidazo[1,2-b]pyridazine-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 6-iodoimidazo[1,2-b]pyridazine-2-carboxylate (CAS 1005786-10-6) is a chemical compound with the molecular formula C9H8IN3O2 and a molecular weight of 317.08 g/mol. IUPAC name: ethyl 6-iodoimidazo[1,2-b]pyridazine-2-carboxylate. InChIKey: IOFOQBGKWGVLDW-UHFFFAOYSA-N.
| Molecular formula | C9H8IN3O2 |
|---|---|
| Molecular weight | 317.08 g/mol |
| IUPAC name | ethyl 6-iodoimidazo[1,2-b]pyridazine-2-carboxylate |
| InChIKey | IOFOQBGKWGVLDW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=N1)C=CC(=N2)I |
Computed by PubChem (NCBI)