CAS 100596-38-1 is the registry number for Dimethyl 5-(2-amino-4-(methoxycarbonyl)phenoxy)isophthalate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 5-(2-amino-4-methoxycarbonylphenoxy)benzene-1,3-dicarboxylate (CAS 100596-38-1) is a chemical compound with the molecular formula C18H17NO7 and a molecular weight of 359.3 g/mol. IUPAC name: dimethyl 5-(2-amino-4-methoxycarbonylphenoxy)benzene-1,3-dicarboxylate. InChIKey: XPNBOEYBQIADSG-UHFFFAOYSA-N.
| Molecular formula | C18H17NO7 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | dimethyl 5-(2-amino-4-methoxycarbonylphenoxy)benzene-1,3-dicarboxylate |
| InChIKey | XPNBOEYBQIADSG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)OC2=CC(=CC(=C2)C(=O)OC)C(=O)OC)N |
Computed by PubChem (NCBI)